CymitQuimica logo

CAS 324-32-3

:

Quinoline, 2-methyl-7-(trifluoromethyl)-

Description:
Quinoline, 2-methyl-7-(trifluoromethyl)-, also known by its CAS number 324-32-3, is a heterocyclic aromatic compound characterized by a fused bicyclic structure comprising a benzene ring and a pyridine ring. This compound features a methyl group at the second position and a trifluoromethyl group at the seventh position of the quinoline ring system, which significantly influences its chemical properties and reactivity. Quinoline derivatives are known for their diverse biological activities, including antimicrobial and antimalarial properties. The presence of the trifluoromethyl group enhances lipophilicity and can improve the compound's metabolic stability. In terms of physical properties, quinoline derivatives typically exhibit moderate to high boiling points and are often soluble in organic solvents. The compound's unique structure and functional groups make it of interest in various fields, including pharmaceuticals, agrochemicals, and materials science. Safety data should be consulted for handling and exposure guidelines, as with all chemical substances.
Formula:C11H8F3N
InChI:InChI=1S/C11H8F3N/c1-7-2-3-8-4-5-9(11(12,13)14)6-10(8)15-7/h2-6H,1H3
InChI key:VIBTYGFMDABZCD-UHFFFAOYSA-N
SMILES:CC1=NC2=C(C=C1)C=CC(=C2)C(F)(F)F
Found 4 products.