CAS 3240-11-7
:phenylacetylene-D
Description:
Phenylacetylene-D, with the CAS number 3240-11-7, is a deuterated form of phenylacetylene, which is an alkyne compound featuring a phenyl group attached to an acetylene moiety. The presence of deuterium, a stable isotope of hydrogen, in its structure allows for applications in various fields, particularly in NMR spectroscopy and studies involving isotopic labeling. This compound typically exhibits characteristics common to alkynes, such as a linear geometry around the triple bond and the ability to participate in reactions typical of alkynes, including addition reactions and polymerization. Its deuterated nature can enhance the sensitivity and resolution of spectroscopic techniques, making it valuable in research settings. Additionally, phenylacetylene-D may be used in organic synthesis and as a building block in the preparation of more complex molecules. Overall, its unique isotopic composition and structural features make it a significant compound in both theoretical and applied chemistry.
Formula:C8H6
InChI:InChI=1S/C8H6/c1-2-8-6-4-3-5-7-8/h1,3-7H/i1D
InChI key:UEXCJVNBTNXOEH-MICDWDOJSA-N
SMILES:[2H]C#CC1=CC=CC=C1
Synonyms:- Phenyl(acetylene-d)
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethynyl-2-d-benzene
CAS:Controlled ProductApplications Ethynyl-2-d-benzene is a useful labeled building block for organic synthesis.
Formula:C8DH5Color and Shape:NeatMolecular weight:103.139


