CAS 3240-91-3

N-benzyl-2-phenylethanamine hydrochloride (1:1)

Description:

N-benzyl-2-phenylethanamine hydrochloride, with the CAS number 3240-91-3, is a chemical compound that belongs to the class of phenethylamines. It features a benzyl group and a phenyl group attached to an ethylamine backbone, which contributes to its structural complexity and potential biological activity. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in research and pharmaceuticals. N-benzyl-2-phenylethanamine hydrochloride may exhibit stimulant properties and has been studied for its interactions with neurotransmitter systems. Its characteristics include a relatively high melting point and stability under standard laboratory conditions. However, due to its psychoactive potential, it is essential to handle this compound with care, adhering to safety protocols and regulations. As with many amines, it may also participate in various chemical reactions, including alkylation and acylation, making it a versatile intermediate in organic synthesis.

Formula: C₁₅H₁₈ClN

InChI: InChI=1/C15H17N.ClH/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15;/h1-10,16H,11-13H2;1H

InChI key: WJRAHTYSUHPAAT-UHFFFAOYSA-N

SMILES: c1ccc(cc1)CCNCc1ccccc1.Cl

Synonyms:

• benzeneethanamine, N-(phenylmethyl)-, hydrochloride (1:1)
• N-benzyl-beta-phenylethylamine HCl
• N-Benzyl-2-phenylethanamine hydrochloride (1:1)

benzyl(2-phenylethyl)amine hydrochloride

CAS: 3240-91-3

Formula: C₁₅H₁₈ClN

Purity: 95%

Molecular weight: 247.7631

Ref: IN-DA007GJT