CAS 3240-95-7

Benzeneethanamine, N-(phenylmethylene)-

Description:

Benzeneethanamine, N-(phenylmethylene)-, also known as benzylidene phenylamine, is an organic compound characterized by its amine functional group and a benzylidene moiety. It features a phenyl group attached to a methylene bridge, which connects to an ethylamine structure. This compound typically appears as a solid or liquid at room temperature, depending on its purity and specific conditions. It is known for its aromatic properties due to the presence of benzene rings, which contribute to its stability and reactivity. Benzeneethanamine, N-(phenylmethylene)- may exhibit various chemical behaviors, including potential reactivity in electrophilic aromatic substitution reactions and the ability to form hydrogen bonds due to its amine group. It is often utilized in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, and other chemical compounds. Safety data should be consulted, as it may pose health risks if not handled properly, including potential irritant effects.

Formula: C₁₅H₁₅N

InChI: InChI=1S/C15H15N/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15/h1-10,13H,11-12H2

InChI key: InChIKey=OOBAKFDIGIHHOM-UHFFFAOYSA-N

SMILES: C(CN=CC1=CC=CC=C1)C2=CC=CC=C2

N-Benzylidenephenethylamine

Controlled Product

CAS: 3240-95-7

Formula: C₁₅H₁₅N

Color and Shape: Neat

Molecular weight: 209.29

Ref: TR-B279635