CAS 324020-70-4

1-(7-Fluoro-2-naphthalenyl)ethanone

Description:

1-(7-Fluoro-2-naphthalenyl)ethanone, identified by its CAS number 324020-70-4, is an organic compound characterized by the presence of a naphthalene ring substituted with a fluorine atom and an ethanone functional group. This compound typically exhibits a solid state at room temperature and is likely to be soluble in organic solvents due to its aromatic structure. The fluorine substitution can influence its chemical reactivity and physical properties, such as boiling and melting points, as well as its polarity. The presence of the naphthalene moiety suggests potential applications in organic synthesis and materials science, particularly in the development of fluorescent dyes or pharmaceuticals. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system of the naphthalene ring, which can be relevant in various chemical reactions and interactions. As with many fluorinated compounds, it may also display unique biological activities, making it a subject of interest in medicinal chemistry.

Formula: C₁₂H₉FO

InChI: InChI=1S/C12H9FO/c1-8(14)10-3-2-9-4-5-12(13)7-11(9)6-10/h2-7H,1H3

InChI key: InChIKey=UXFZUFVOHYDZLR-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC2=C(C=C1)C=CC(F)=C2

Synonyms:

• 1-(7-Fluoro-2-naphthalenyl)ethanone
• 1-(7-Fluoronaphthalen-2-yl)ethan-1-one
• Ethanone, 1-(7-fluoro-2-naphthalenyl)-

2-Acetyl-7-fluoronaphthalene

Controlled Product

CAS: 324020-70-4

Formula: C₁₂H₉FO

Color and Shape: Neat

Molecular weight: 188.198

Ref: TR-A396245