CAS 324028-06-0

2-acetamido-3-(3,4,5-trifluorophenyl)propanoic acid

Description:

2-Acetamido-3-(3,4,5-trifluorophenyl)propanoic acid, with the CAS number 324028-06-0, is an organic compound characterized by its unique structure that includes an acetamido group and a trifluorophenyl moiety. This compound typically exhibits properties associated with both amino acids and aromatic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid and amide functional groups. The trifluorophenyl group contributes to its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The presence of fluorine atoms can enhance metabolic stability and alter the compound's interaction with biological targets. Additionally, this compound may exhibit specific reactivity patterns typical of amino acids, such as forming peptide bonds or participating in various chemical reactions. Overall, 2-acetamido-3-(3,4,5-trifluorophenyl)propanoic acid is a compound of interest in medicinal chemistry, particularly for its potential applications in drug development and biochemical research.

Formula: C₁₁H₁₀F₃NO₃

InChI: InChI=1/C11H10F3NO3/c1-5(16)15-9(11(17)18)4-6-2-7(12)10(14)8(13)3-6/h2-3,9H,4H2,1H3,(H,15,16)(H,17,18)

InChI key: MJBCGFLRYSZAPQ-UHFFFAOYSA-N

SMILES: CC(=NC(Cc1cc(c(c(c1)F)F)F)C(=O)O)O

2-Acetamido-3-(3,4,5-trifluorophenyl)propanoic acid

CAS: 324028-06-0

Formula: C₁₁H₁₀F₃NO₃

Molecular weight: 261.1972

Ref: IN-DA00BZQT