CymitQuimica logo

CAS 324028-89-9

:

5,6-Dimethoxy-2-pyridinecarboxylic acid

Description:
5,6-Dimethoxy-2-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a carboxylic acid group and at the 5 and 6 positions with methoxy groups. This structure contributes to its unique chemical properties, including its potential as a ligand in coordination chemistry and its role in various synthetic pathways. The presence of the carboxylic acid group imparts acidic characteristics, allowing it to participate in acid-base reactions, while the methoxy groups enhance its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The compound is of interest in medicinal chemistry and material science due to its potential biological activity and utility in the synthesis of more complex molecules. Its CAS number, 324028-89-9, serves as a unique identifier for regulatory and research purposes. Overall, 5,6-Dimethoxy-2-pyridinecarboxylic acid exemplifies the diverse functionalities that can arise from simple organic structures.
Formula:C8H9NO4
InChI:InChI=1S/C8H9NO4/c1-12-6-4-3-5(8(10)11)9-7(6)13-2/h3-4H,1-2H3,(H,10,11)
InChI key:InChIKey=KUYQYZCJTXNORX-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=CC(C(O)=O)=N1
Synonyms:
  • 5,6-Dimethoxypicolinic acid
  • 2-Pyridinecarboxylic acid, 5,6-dimethoxy-
  • 5,6-Dimethoxy-2-pyridinecarboxylic acid
  • 5,6-Dimethoxypyridine-2-carboxylic acid
Found 4 products.