CymitQuimica logo

CAS 324063-66-3

:

oxo[bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)]stannane

Description:
Oxo[bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)]stannane is a specialized organotin compound characterized by its unique structure, which includes a tin atom bonded to two tridecafluorooctyl groups. This compound exhibits properties typical of organotin derivatives, such as potential applications in surface modification and as a stabilizer in various materials. The presence of multiple fluorinated alkyl chains imparts hydrophobic and oleophobic characteristics, making it suitable for use in coatings and treatments that require water and oil repellency. Additionally, the oxo functional group contributes to its reactivity and potential interactions with other chemical species. Due to the presence of tin, this compound may also exhibit some level of toxicity, which necessitates careful handling and consideration of environmental impacts. Overall, oxo[bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)]stannane is notable for its unique fluorinated structure and its potential utility in advanced material applications.
Formula:C16H8F26OSn
InChI:InChI=1/2C8H4F13.O.Sn/c2*1-2-3(9,10)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;;/h2*1-2H2;;/rC16H8F26OSn/c17-5(18,7(21,22)9(25,26)11(29,30)13(33,34)15(37,38)39)1-3-44(43)4-2-6(19,20)8(23,24)10(27,28)12(31,32)14(35,36)16(40,41)42/h1-4H2
InChI key:VCPJPAQHWCNPKF-UHFFFAOYSA-N
SMILES:C(C[Sn](=O)CCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Found 1 products.