CAS 32412-45-6

1-(5-bromothiophen-2-yl)-2-methylpropan-1-one

Description:

1-(5-Bromothiophen-2-yl)-2-methylpropan-1-one, with the CAS number 32412-45-6, is an organic compound characterized by its unique structure that includes a thiophene ring substituted with a bromine atom and a ketone functional group. This compound typically exhibits a yellow to brown color and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic thiophene moiety. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including electrophilic substitutions. Additionally, the compound may exhibit biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. Its molecular structure contributes to its physical properties, such as melting and boiling points, which are influenced by intermolecular forces. Overall, 1-(5-bromothiophen-2-yl)-2-methylpropan-1-one is a versatile compound with potential applications in synthetic organic chemistry and material science.

Formula: C₈H₉BrOS

InChI: InChI=1/C8H9BrOS/c1-5(2)8(10)6-3-4-7(9)11-6/h3-5H,1-2H3

InChI key: SFBZUUSWOBQSEA-UHFFFAOYSA-N

SMILES: CC(C)C(=O)c1ccc(Br)s1

1-(5-Bromo-2-thienyl)-2-methyl-1-propanone

CAS: 32412-45-6

1-(5-Bromo-2-thienyl)-2-methyl-1-propanone

Formula: C₈H₉BrOS

Molecular weight: 233.13

Ref: 54-OR1091867