CAS 32418-08-9

3-(1-Methylethyl)-6-nitro-2(3H)-benzoxazolone

Description:

3-(1-Methylethyl)-6-nitro-2(3H)-benzoxazolone, with the CAS number 32418-08-9, is an organic compound characterized by its benzoxazolone structure, which features a fused benzene and oxazolone ring. This compound typically exhibits a yellow to orange color, attributed to the presence of the nitro group, which can influence its electronic properties and reactivity. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, potentially affecting its solubility in various solvents. The nitro group is known for its electron-withdrawing properties, which can impact the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, this compound may exhibit fluorescence, making it useful in various applications, including as a dye or in biological assays. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-(1-Methylethyl)-6-nitro-2(3H)-benzoxazolone is a versatile compound with potential applications in organic synthesis and materials science.

Formula: C₁₀H₁₀N₂O₄

InChI: InChI=1S/C10H10N2O4/c1-6(2)11-8-4-3-7(12(14)15)5-9(8)16-10(11)13/h3-6H,1-2H3

InChI key: InChIKey=PCJXQVJIUFVRTH-UHFFFAOYSA-N

SMILES: C(C)(C)N1C=2C(=CC(N(=O)=O)=CC2)OC1=O

Synonyms:

• 3-(1-Methylethyl)-6-nitro-2(3H)-benzoxazolone
• 2(3H)-Benzoxazolone, 3-(1-methylethyl)-6-nitro-
• 3-Isopropyl-6-nitrobenzo[d]oxazol-2(3H)-one
• 2-Benzoxazolinone, 3-isopropyl-6-nitro-
• 6-Nitro-3-isopropyl-3H-benzoxazol-2-one
• 3-Isopropyl-6-nitro-1,3-benzoxazol-2-one

3-Isopropyl-6-nitro-1,3-benzoxazol-2-one

CAS: 32418-08-9

Formula: C₁₀H₁₀N₂O₄

Molecular weight: 222.1974

Ref: IN-DA00CLV7