CAS 32418-99-8

3-Aminotetrahydro-3-thiophenecarboxylic acid

Description:

3-Aminotetrahydro-3-thiophenecarboxylic acid is a chemical compound characterized by its unique structure, which includes a thiophene ring fused with a tetrahydro group and an amino and carboxylic acid functional group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the thiophene ring contributes to its potential for aromaticity and may impart specific electronic properties, making it of interest in various chemical applications, including pharmaceuticals and organic synthesis. The amino group can participate in nucleophilic reactions, while the carboxylic acid can engage in acid-base chemistry. Additionally, the compound may exhibit biological activity, which could be relevant for medicinal chemistry. Overall, 3-Aminotetrahydro-3-thiophenecarboxylic acid is a versatile compound with potential applications in various fields, including drug development and materials science.

Formula: C₅H₉NO₂S

InChI: InChI=1S/C5H9NO2S/c6-5(4(7)8)1-2-9-3-5/h1-3,6H2,(H,7,8)

InChI key: InChIKey=SAKWWHXZZFRWCN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(N)CCSC1

Synonyms:

• 3-Aminotetrahydro-3-thiophenecarboxylic acid
• 3-Aminothiolane-3-carboxylic acid
• 3-Thiophenecarboxylic Acid, 3-Aminotetrahydro-
• 3-Aminotetrahydrothiophene-3-carboxylic acid

3-Amino-tetrahydro-thiophene-3-carboxylic acid

CAS: 32418-99-8

Formula: C₅H₉NO₂S

Molecular weight: 147.1955

Ref: IN-DA007GJJ