CymitQuimica logo

CAS 32427-77-3

:

1-(5-chlorothiophen-2-yl)butan-1-one

Description:
1-(5-Chlorothiophen-2-yl)butan-1-one, with the CAS number 32427-77-3, is an organic compound characterized by its structure, which includes a butanone moiety and a chlorothiophene ring. This compound typically exhibits a yellow to brownish color and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the chlorothiophene group contributes to its potential reactivity and biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its molecular structure suggests that it may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the chlorine atom. Additionally, the butanone part of the molecule indicates that it may have ketone functional properties, which can influence its reactivity and interactions with other chemical species. Safety data should be consulted for handling, as compounds with halogenated aromatic systems can pose health risks. Overall, this compound's unique structure and properties make it a subject of interest for further research and application.
Formula:C8H9ClOS
InChI:InChI=1/C8H9ClOS/c1-2-3-6(10)7-4-5-8(9)11-7/h4-5H,2-3H2,1H3
InChI key:BIDANQRTCBSNEM-UHFFFAOYSA-N
SMILES:CCCC(=O)c1ccc(Cl)s1
Synonyms:
  • 1-(5-Chloro-2-thienyl)butan-1-one
  • 1-Butanone, 1-(5-Chloro-2-Thienyl)-
Found 3 products.