CAS 3243-41-2

4-Butoxybenzenepropanoic acid

Description:

4-Butoxybenzenepropanoic acid, also known by its CAS number 3243-41-2, is an organic compound characterized by its aromatic structure and functional groups. It features a butoxy group attached to a benzene ring, which is further connected to a propanoic acid moiety. This compound typically exhibits properties associated with both aromatic compounds and carboxylic acids, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The butoxy substituent can influence its hydrophobic characteristics, making it less soluble in water compared to simpler carboxylic acids. 4-Butoxybenzenepropanoic acid may be utilized in various applications, including as an intermediate in organic synthesis or in the formulation of certain chemical products. Its specific physical and chemical properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is used. Safety data should be consulted for handling and usage guidelines.

Formula: C₁₃H₁₈O₃

InChI: InChI=1S/C13H18O3/c1-2-3-10-16-12-7-4-11(5-8-12)6-9-13(14)15/h4-5,7-8H,2-3,6,9-10H2,1H3,(H,14,15)

InChI key: InChIKey=HYKVUYCXAYOAKZ-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=CC=C(OCCCC)C=C1

Synonyms:

• 3-(4-Butoxyphenyl)propanoic acid
• 4-Butoxybenzenepropanoic acid
• Hydrocinnamic acid, p-butoxy-
• Hydrocinnamicacid, p-butoxy- (7CI,8CI)
• Benzenepropanoic acid, 4-butoxy-

3-(4-Butoxyphenyl)propanoic acid

CAS: 3243-41-2

Formula: C₁₃H₁₈O₃

Molecular weight: 222.2802

Ref: IN-DA007G5D