CymitQuimica logo

CAS 32431-84-8

:

3-Fluoro-2-thiophenecarboxylic acid

Description:
3-Fluoro-2-thiophenecarboxylic acid is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The compound features a carboxylic acid functional group (-COOH) and a fluorine atom positioned at the 3rd carbon of the thiophene ring, while the carboxylic acid is located at the 2nd carbon. This structure imparts unique chemical properties, including potential acidity due to the carboxylic group and reactivity influenced by the electron-withdrawing nature of the fluorine atom. The presence of the thiophene ring contributes to its aromaticity and stability, while the functional groups can participate in various chemical reactions, such as esterification or nucleophilic substitution. 3-Fluoro-2-thiophenecarboxylic acid may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its specific physical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods or referenced from chemical databases.
Formula:C5H3FO2S
InChI:InChI=1S/C5H3FO2S/c6-3-1-2-9-4(3)5(7)8/h1-2H,(H,7,8)
InChI key:InChIKey=WPHRBUAOSDHRDS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C=CS1
Synonyms:
  • 2-Thiophenecarboxylic Acid, 3-Fluoro-
  • 3-Fluorothiophene-2-carboxylic acid
  • 3-Fluoro-2-thiophenecarboxylic acid
Found 5 products.