CAS 32432-55-6
:3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid
Description:
3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid, with the CAS number 32432-55-6, is an organic compound characterized by its sulfonic acid functional group and multiple amino groups attached to a trimethyl-substituted benzene ring. This compound typically appears as a solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its polarity. The amino groups contribute to its basicity and potential reactivity, making it useful in various chemical applications, including as a dye intermediate or in the synthesis of other organic compounds. Its structure allows for multiple points of reactivity, which can be exploited in chemical reactions, such as coupling reactions in dye chemistry. Additionally, the presence of methyl groups on the benzene ring can influence its electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H14N2O3S
InChI:InChI=1S/C9H14N2O3S/c1-4-7(10)5(2)9(15(12,13)14)6(3)8(4)11/h10-11H2,1-3H3,(H,12,13,14)
InChI key:InChIKey=PKKGGWLTUCMSSD-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=C(C)C(N)=C(C)C(N)=C1C
Synonyms:- 2,4-Diamino-1,3,5-trimethylbenzene-6-sulfonic acid
- 2,4-Diaminomesitylene-6-sulfonic acid
- 2,6-Diamino-1,3,5-trimethylbenzene-4-sulfonic acid
- 3,5-Diamino-2,4,6-Trimethylbenzenesulfonate
- 3,5-Diamino-2,4,6-Trimethylbenzenesulfonic Acid
- Benzenesulfonic acid, 3,5-diamino-2,4,6-trimethyl-
- Diaminomesitylenesulfonic acid
- M Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,5-Diamino-2,4,6-trimethylbenzenesulfonic Acid
CAS:Formula:C9H14N2O3SPurity:>93.0%(T)Color and Shape:White - Yellow Solid FormMolecular weight:230.283,5-Diamino-2,4,6-trimethylbenzenesulfonic Acid
CAS:3,5-Diamino-2,4,6-trimethylbenzenesulfonic AcidFormula:C9H14N2O3SPurity:>93.0%Molecular weight:230.283,5-Diamino-2,4,6-trimethylbenzenesulfonic Acid
CAS:Formula:C9H14N2O3SPurity:93.0%Color and Shape:SolidMolecular weight:230.28413,5-Diamino-2,4,6-trimethylbenzenesulfonic acid
CAS:Formula:C9H14N2O3SPurity:95.0%Color and Shape:No data available.Molecular weight:230.283,5-Diamino-2,4,6-trimethylbenzenesulfonicacid
CAS:3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid (DTMS) is an aromatic hydrocarbon that has been found in the environment. DTMS is used as a chlorine scavenger in water treatment plants and wastewater treatment facilities to remove chlorinated organics from the water. It has been shown to be a ligand for uranium. DTMS reacts with cyanuric acid to form 3,5-dichloro-2,4,6-trimethylbenzenesulfonyl chloride (CAS No. 52834-57-1). DTMS also exhibits affinity for metal ions such as copper and nickel.
Formula:C9H14N2O3SPurity:90%NmrMolecular weight:230.29 g/mol




