CAS 32444-32-9

Formula: C7H14O2

InChI: InChI=1S/C7H14O2/c1-4-6(5(2)3)7(8)9/h5-6H,4H2,1-3H3,(H,8,9)

InChI key: XJCPTWKSNPIJRN-UHFFFAOYSA-N

SMILES: CCC(C(C)C)C(=O)O

2-Ethyl-3-methylbutanoic acid

CAS: 32444-32-9

2-Ethyl-3-methylbutanoic acid

Formula: C₇H₁₄O₂

Purity: 95%

Molecular weight: 130.18

Ref: 54-OR1125138

2-Ethyl-3-methylbutanoic acid

CAS: 32444-32-9

Formula: C₇H₁₄O₂

Purity: 95%

Molecular weight: 130.1849

Ref: IN-DA007G5A

2-Ethyl-3-methylbutanoic acid

CAS: 32444-32-9

2-Ethyl-3-methylbutanoic acid is a plant cell-active compound that belongs to the group of alkylating agents. It is an acetaldehyde analogue and can be used for the synthesis of trachelanthamine, which is a skeleton building agent in the biosynthesis pathway for valine. 2-Ethyl-3-methylbutanoic acid is activated by incubation with unlabelled ethyl groups. This compound can also be used to synthesize acetaldehyde, which can be analyzed using chromatography.

Formula: C₇H₁₄O₂

Purity: Min. 95%

Molecular weight: 130.18 g/mol

Ref: 3D-HBA44432