CymitQuimica logo

CAS 32449-80-2

:

L-Glucuronic acid, g-lactone

Description:
L-Glucuronic acid, γ-lactone, is a derivative of glucuronic acid, characterized by the presence of a lactone functional group. This compound is typically a white to off-white solid that is soluble in water, reflecting its polar nature due to the presence of hydroxyl groups. It plays a significant role in biological systems, particularly in the detoxification processes where it conjugates with various substances to facilitate their excretion. The lactone form can influence its reactivity and stability, making it an important intermediate in biochemical pathways. L-Glucuronic acid, γ-lactone is also utilized in various applications, including pharmaceuticals and biochemistry, where it may serve as a building block for glycosaminoglycans or other polysaccharides. Its chemical structure includes multiple hydroxyl groups, contributing to its hydrophilicity and reactivity. Overall, this compound is significant in both natural and synthetic chemistry contexts, particularly in relation to metabolic processes and drug development.
Formula:C6H8O6
InChI:InChI=1S/C6H8O6/c7-1-3-4(12-5(1)9)2(8)6(10)11-3/h1-5,7-9H/t1-,2+,3?,4+,5?/m1/s1
InChI key:OGLCQHRZUSEXNB-UCDXPBRXSA-N
SMILES:[C@H]12[C@@H](C(=O)OC1[C@H](C(O2)O)O)O
Synonyms:
  • Glucuronicacid, g-lactone, L- (8CI)
  • L-Glucurono-3,6-lactone
  • Glucuronic acid, γ-lactone, L- (8CI)
  • L-Glucuronic acid, γ-lactone
Found 2 products.