CymitQuimica logo

CAS 3245-44-1

:

1-(2-bromoethoxy)-2-isopropyl-benzene

Description:
1-(2-Bromoethoxy)-2-isopropyl-benzene, with the CAS number 3245-44-1, is an organic compound characterized by its aromatic structure and the presence of both a bromine atom and an ethoxy group. This compound features a benzene ring substituted with an isopropyl group at one position and a bromoethoxy group at another, which contributes to its unique chemical properties. The presence of the bromine atom makes it a potential electrophile, while the ethoxy group can influence its solubility and reactivity. Typically, compounds like this may exhibit moderate to high lipophilicity due to the aromatic and aliphatic components, affecting their behavior in biological systems and their interactions with other chemicals. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C11H15BrO
InChI:InChI=1/C11H15BrO/c1-9(2)10-5-3-4-6-11(10)13-8-7-12/h3-6,9H,7-8H2,1-2H3
InChI key:DAGDLSRRQJATCV-UHFFFAOYSA-N
SMILES:CC(C)c1ccccc1OCCBr
Found 1 products.