CymitQuimica logo

CAS 3245-53-2

:

1-(3-bromopropoxy)-3,5-dimethylbenzene

Description:
1-(3-Bromopropoxy)-3,5-dimethylbenzene, with the CAS number 3245-53-2, is an organic compound characterized by its aromatic structure and the presence of both bromine and ether functional groups. This compound features a bromopropoxy substituent attached to a dimethyl-substituted benzene ring, which contributes to its unique chemical properties. The bromine atom introduces reactivity, making it a potential candidate for nucleophilic substitution reactions. The dimethyl groups on the benzene ring enhance steric hindrance and influence the compound's solubility and reactivity. Typically, compounds of this nature exhibit moderate to low solubility in water but may dissolve well in organic solvents. The presence of the bromine atom can also impart biological activity, making it of interest in medicinal chemistry and materials science. Additionally, the compound's physical properties, such as boiling point and melting point, are influenced by its molecular structure and the interactions between its functional groups. Overall, 1-(3-bromopropoxy)-3,5-dimethylbenzene is a versatile compound with potential applications in various chemical syntheses and research fields.
Formula:C11H15BrO
InChI:InChI=1/C11H15BrO/c1-9-6-10(2)8-11(7-9)13-5-3-4-12/h6-8H,3-5H2,1-2H3
InChI key:FGTRKEKWAVDNIK-UHFFFAOYSA-N
SMILES:Cc1cc(C)cc(c1)OCCCBr
Found 1 products.