CymitQuimica logo

CAS 324575-10-2

:

bis(trifluoromethylsulfonyl)azanide; tributyl(methyl)phosphonium

Description:
Bis(trifluoromethylsulfonyl)azanide, also known as tributyl(methyl)phosphonium, is a chemical compound characterized by its unique structure and properties. It features a phosphonium cation, which is a positively charged species containing a phosphorus atom bonded to three butyl groups and one methyl group, contributing to its hydrophobic nature. The anionic part, bis(trifluoromethylsulfonyl)azanide, consists of a nitrogen atom bonded to two trifluoromethylsulfonyl groups, which are known for their strong electron-withdrawing properties. This combination results in a compound that exhibits high thermal stability and solubility in polar solvents. Additionally, the presence of trifluoromethyl groups enhances its reactivity and potential applications in various fields, including ionic liquids and catalysis. The compound is typically handled with care due to its potential toxicity and environmental impact, necessitating appropriate safety measures during use. Overall, bis(trifluoromethylsulfonyl)azanide; tributyl(methyl)phosphonium is notable for its distinctive chemical characteristics and versatility in chemical applications.
Formula:C15H30F6NO4PS2
InChI:InChI=1/C13H30P.C2F6NO4S2/c1-5-8-11-14(4,12-9-6-2)13-10-7-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-13H2,1-4H3;/q+1;-1
InChI key:YJPDLBMZLGTDRZ-UHFFFAOYSA-N
SMILES:CCCC[P+](C)(CCCC)CCCC.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
Found 5 products.