CAS 32460-00-7
:2,5-Dibromofuran
Description:
2,5-Dibromofuran is a heterocyclic organic compound characterized by a furan ring substituted with two bromine atoms at the 2 and 5 positions. Its molecular formula is C4H2Br2O, indicating the presence of carbon, hydrogen, bromine, and oxygen. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. 2,5-Dibromofuran is known for its reactivity due to the presence of bromine substituents, which can participate in various chemical reactions, including electrophilic substitution and nucleophilic addition. It is often used in organic synthesis as an intermediate for the preparation of more complex molecules, particularly in the development of pharmaceuticals and agrochemicals. The compound's properties, such as boiling point, melting point, and solubility, can vary based on its specific form and purity. Safety precautions should be taken when handling this substance, as brominated compounds can be hazardous. Always refer to material safety data sheets (MSDS) for detailed safety and handling information.
Formula:C4H2Br2O
InChI:InChI=1/C4H2Br2O/c5-3-1-2-4(6)7-3/h1-2H
SMILES:c1cc(Br)oc1Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,5-Dibromofuran
CAS:2,5-DibromofuranFormula:C4H2Br2OPurity:99%Color and Shape:LiquidMolecular weight:225.872,5-Dibromofuran
CAS:2,5-DibromofuranFormula:C4H2Br2OPurity:99% (stabilized with MgO)Molecular weight:225.872,5-Dibromofuran (stabilised with MgO)
CAS:Formula:C4H2Br2OPurity:95.0%Color and Shape:Liquid, OilMolecular weight:225.8672,5-Dibromofuran (>85%)
CAS:Controlled ProductFormula:C4H2Br2OPurity:>85%Color and Shape:NeatMolecular weight:225.872,5-Dibromofuran
CAS:2,5-Dibromofuran is a synthetic chemical that is synthesized from acetonitrile and palladium-catalyzed cross-coupling reaction. It can be obtained by the reaction of sodium in anhydrous form with bromine and subsequent evaporation to dryness. 2,5-Dibromofuran has been shown to reversibly react with chloride at room temperature for one hour, which can be attributed to its electron withdrawing properties. The FTIR spectra of 2,5-dibromofuran show bands corresponding to carbonyl and hydroxyl groups. This chemical has been used in synthesis methods involving surfactants and anhydrous sodium chloride as well as uv irradiation.Formula:C4H2Br2OPurity:Min. 95%Molecular weight:225.87 g/mol





