CymitQuimica logo

CAS 32460-22-3

:

3-Furancarboxylic acid, 2,5-dibromo-

Description:
3-Furancarboxylic acid, 2,5-dibromo- is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. The presence of carboxylic acid functional group (-COOH) indicates its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The dibromo substituents at the 2 and 5 positions of the furan ring enhance its reactivity and influence its physical properties, such as solubility and boiling point. This compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the carboxylic acid group. Its bromine atoms can also impart unique characteristics, such as increased reactivity in electrophilic substitution reactions. 3-Furancarboxylic acid, 2,5-dibromo- may find applications in organic synthesis, pharmaceuticals, and agrochemicals, owing to its functional groups and structural features that allow for further chemical modifications. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C5H2Br2O3
InChI:InChI=1S/C5H2Br2O3/c6-3-1-2(5(8)9)4(7)10-3/h1H,(H,8,9)
InChI key:InChIKey=UFFSHBPITAYYJR-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(Br)OC1Br
Synonyms:
  • 3-Furancarboxylic acid, 2,5-dibromo-
  • 2,5-Dibromofuran-3-carboxylic acid
  • 3-Furoic acid, 2,5-dibromo-
Found 3 products.