
CAS 324742-96-3
:5-Thiazoleethanol, 4-methyl-, 5-propanoate
Description:
5-Thiazoleethanol, 4-methyl-, 5-propanoate, identified by its CAS number 324742-96-3, is a chemical compound that belongs to the class of thiazole derivatives. This substance features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of the propanoate group indicates that it is an ester, which typically contributes to its reactivity and solubility characteristics. The methyl group at the 4-position of the thiazole ring can influence the compound's biological activity and physical properties, such as melting point and boiling point. Generally, thiazole derivatives are known for their diverse applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific characteristics, such as solubility, stability, and reactivity, can vary based on the molecular structure and substituents present. For detailed information regarding its applications, safety data, and handling procedures, consulting material safety data sheets (MSDS) and scientific literature is recommended.
Formula:C9H13NO2S
InChI:InChI=1S/C9H13NO2S/c1-3-9(11)12-5-4-8-7(2)10-6-13-8/h6H,3-5H2,1-2H3
InChI key:InChIKey=KXYXTLJGFPUWOE-UHFFFAOYSA-N
SMILES:C(COC(CC)=O)C1=C(C)N=CS1
Synonyms:- 2-(4-Methylthiazol-5-yl)ethyl propionate
- 1-(4-Methyl-thiazol-5-yl)-2-propionyloxy-ethane
- 5-Thiazoleethanol, 4-methyl-, 5-propanoate
- 5-Thiazoleethanol, 4-methyl-, propanoate (ester)
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
