CymitQuimica logo

CAS 324751-00-0

:

3-(Quinolin-2-yl)benzaldehyde

Description:
3-(Quinolin-2-yl)benzaldehyde is an organic compound characterized by the presence of both a quinoline and a benzaldehyde functional group. Its molecular structure features a benzaldehyde moiety attached to the 3-position of a quinoline ring system, which contributes to its unique chemical properties. This compound typically appears as a yellow to brown solid and is soluble in organic solvents such as ethanol and dichloromethane. It exhibits notable fluorescence, making it of interest in various applications, including organic synthesis and as a potential fluorescent probe. The presence of the quinoline ring imparts basic properties, allowing it to participate in various chemical reactions, such as electrophilic substitutions and condensation reactions. Additionally, 3-(Quinolin-2-yl)benzaldehyde may exhibit biological activity, which has led to investigations into its potential as a pharmaceutical intermediate or in the development of new materials. As with many organic compounds, proper handling and safety precautions are essential due to its potential toxicity and reactivity.
Formula:C16H11NO
InChI:InChI=1S/C16H11NO/c18-11-12-4-3-6-14(10-12)16-9-8-13-5-1-2-7-15(13)17-16/h1-11H
InChI key:IBPRTGBCAVNVDQ-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C=CC(=N2)C3=CC=CC(=C3)C=O
Synonyms:
  • 9,10-Bis(3-formylphenyl)anthracene
  • 3,3'-(anthracene-9,10-diyl)dibenzaldehyde
  • 3,3'-(3,5-Pyridinediyl)bisbenzaldehyde
  • 3,3'-(2,6-Pyrazinediyl)bisbenzaldehyde
  • 3-(Quinolin-2-yl)benzaldehyde
  • Benzaldehyde, 3,3'-(9,10-anthracenediyl)bis-
  • 3,3'-(2,6-Pyridinediyl)bisbenzaldehyde
  • 3,3'-(4,6-Pyrimidinediyl)bisbenzaldehyde
Found 3 products.