CAS 324753-16-4

(diphenylphosphanyl)methanethiol

Description:

(Diphenylphosphanyl)methanethiol is an organophosphorus compound characterized by the presence of a thiol group (-SH) attached to a methylene bridge that connects to a diphenylphosphanyl group. This compound typically exhibits a molecular structure that includes a phosphorus atom bonded to two phenyl groups and a sulfur atom from the thiol functional group. It is generally a colorless to light yellow liquid with a distinctive odor, indicative of the thiol functionality. The presence of the phosphanyl group suggests potential reactivity, particularly in coordination chemistry and as a ligand in metal complexes. Its thiol group contributes to its ability to form disulfide bonds and participate in redox reactions. Additionally, (diphenylphosphanyl)methanethiol may exhibit moderate solubility in organic solvents, while its reactivity can be influenced by the steric and electronic effects of the diphenyl groups. This compound is of interest in various fields, including catalysis and materials science, due to its unique chemical properties.

Formula: C₁₃H₁₃PS

InChI: InChI=1/C13H13PS/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2

InChI key: IGEZSSBBLDNMPJ-UHFFFAOYSA-N

SMILES: c1ccc(cc1)P(CS)c1ccccc1

(Diphenylphosphino)methanethiol

CAS: 324753-16-4

(Diphenylphosphino)methanethiol is a biomolecular compound that is used in the synthesis of amides and azides, transfer reactions, and biological function. It also has been shown to be an effective site-specific immobilization agent for metal ions. The acidic properties of (Diphenylphosphino)methanethiol make it useful for the Staudinger reduction. This chemical is also used in enzyme catalysis and functional studies to study the mechanism of enzymes.

Formula: C₁₃H₁₃PS

Purity: Min. 95%

Molecular weight: 232.28 g/mol

Ref: 3D-FD22510