CymitQuimica logo

CAS 324761-25-3

:

Pentonic acid, 2,5-dideoxy-3-C-methyl-, γ-lactone, 3-(2-methyl-2-propenoate)

Description:
Pentonic acid, 2,5-dideoxy-3-C-methyl-, γ-lactone, 3-(2-methyl-2-propenoate) is a complex organic compound characterized by its unique structural features. It contains a pentonic acid backbone, which is a five-carbon sugar acid, modified by the presence of dideoxy and C-methyl groups. The γ-lactone structure indicates that it forms a cyclic ester, which is typically derived from the reaction of a hydroxyl group with a carboxylic acid group within the same molecule. The presence of the 3-(2-methyl-2-propenoate) moiety suggests that it has an ester functional group, which can participate in various chemical reactions, including polymerization. This compound may exhibit interesting biological activities due to its structural complexity, potentially influencing its solubility, reactivity, and interaction with biological systems. Its CAS number, 324761-25-3, allows for precise identification in chemical databases, facilitating research and application in fields such as organic synthesis, medicinal chemistry, and biochemistry.
Formula:C10H14O4
InChI:InChI=1S/C10H14O4/c1-6(2)9(12)14-10(4)5-8(11)13-7(10)3/h7H,1,5H2,2-4H3
InChI key:VRVJALFOECGRKH-UHFFFAOYSA-N
SMILES:CC1C(CC(=O)O1)(C)OC(=O)C(=C)C
Synonyms:
  • β,γ-dimethyl-β-methacryloyloxy-γ-butyrolactone
  • Pentonic acid, 2,5-dideoxy-3-C-methyl-, γ-lactone, 3-(2-methyl-2-propenoate)
Found 2 products.