CymitQuimica logo

CAS 324777-59-5

:

1-(2-Naphthalenylsulfonyl)-4-phenylpiperazine

Description:
1-(2-Naphthalenylsulfonyl)-4-phenylpiperazine, identified by its CAS number 324777-59-5, is a chemical compound characterized by its complex structure, which includes a piperazine ring substituted with a phenyl group and a naphthalenesulfonyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the naphthalene ring suggests significant hydrophobic characteristics, while the sulfonyl group may enhance solubility in polar solvents. The piperazine ring is known for its role in pharmacology, often serving as a scaffold in drug design due to its ability to interact with various biological targets. This compound may exhibit various pharmacological activities, including potential effects on the central nervous system, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in research related to drug development or as a chemical probe in biological studies.
Formula:C20H20N2O2S
InChI:InChI=1S/C20H20N2O2S/c23-25(24,20-11-10-17-6-4-5-7-18(17)16-20)22-14-12-21(13-15-22)19-8-2-1-3-9-19/h1-11,16H,12-15H2
InChI key:InChIKey=RKVDGVRGABKUCO-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC2=C(C=C1)C=CC=C2)N3CCN(CC3)C4=CC=CC=C4
Synonyms:
  • 1-(2-Naphthalenylsulfonyl)-4-phenylpiperazine
  • Piperazine, 1-(2-naphthalenylsulfonyl)-4-phenyl-
Found 1 products.