CymitQuimica logo

CAS 32483-16-2

:

N~2~-acetyl-N-methyl-L-isoleucinamide

Description:
N~2~-acetyl-N-methyl-L-isoleucinamide, with the CAS number 32483-16-2, is an organic compound that belongs to the class of amino acid derivatives. It features an acetyl group and a methyl group attached to the nitrogen atom of the isoleucine backbone, which contributes to its unique properties. This compound is characterized by its amide functional group, which typically imparts stability and influences solubility in polar solvents. The presence of the acetyl group enhances its lipophilicity, potentially affecting its biological activity and interactions. N~2~-acetyl-N-methyl-L-isoleucinamide may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in various fields, including biochemistry and pharmaceuticals, where it could serve as a building block for more complex molecules or as a research tool to study protein interactions and metabolic pathways. As with many organic compounds, its behavior in biological systems would depend on factors such as pH, temperature, and the presence of other chemical species.
Formula:C9H18N2O2
InChI:InChI=1/C9H18N2O2/c1-5-6(2)8(9(13)10-4)11-7(3)12/h6,8H,5H2,1-4H3,(H,10,13)(H,11,12)/t6-,8-/m0/s1
InChI key:VFPIEHZHPRLCOB-XPUUQOCRSA-N
SMILES:CC[C@H](C)[C@@H](C(=NC)O)N=C(C)O
Synonyms:
  • pentanamide, 2-(acetylamino)-N,3-dimethyl-, (2S,3S)-
  • N~2~-Acetyl-N-methyl-L-isoleucinamide
Found 2 products.