CymitQuimica logo

CAS 325-14-4

:

7-(Trifluoromethyl)quinoline

Description:
7-(Trifluoromethyl)quinoline is an organic compound characterized by the presence of a quinoline ring system substituted with a trifluoromethyl group at the 7-position. This compound typically exhibits a pale yellow to light brown appearance and is known for its aromatic properties, which contribute to its stability and reactivity. The trifluoromethyl group is a strong electron-withdrawing substituent, which can significantly influence the compound's chemical behavior, including its reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of fluorine atoms enhances the lipophilicity and metabolic stability of the compound, making it of interest in medicinal chemistry and material science. 7-(Trifluoromethyl)quinoline may also exhibit biological activity, potentially serving as a scaffold for the development of pharmaceuticals. Its solubility characteristics can vary depending on the solvent, and it is generally handled with care due to the potential toxicity associated with fluorinated compounds. Overall, this compound is a valuable entity in both synthetic and applied chemistry contexts.
Formula:C10H6F3N
InChI:InChI=1S/C10H6F3N/c11-10(12,13)8-4-3-7-2-1-5-14-9(7)6-8/h1-6H
InChI key:InChIKey=CMMSEFHVUYEEDY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC2=C(C=C1)C=CC=N2
Synonyms:
  • 7-(Trifluoromethyl)quinoline
  • Quinoline, 7-(Trifluoromethyl)-
Found 5 products.