CymitQuimica logo

CAS 325-89-3

:

3-Amino-3-(4-fluorophenyl)propionic acid

Description:
3-Amino-3-(4-fluorophenyl)propionic acid, with the CAS number 325-89-3, is an amino acid derivative characterized by the presence of an amino group and a fluorophenyl substituent on a propionic acid backbone. This compound features a chiral center, which can lead to the existence of enantiomers. It is typically a white to off-white solid and is soluble in water, making it suitable for various biochemical applications. The fluorine atom in the para position of the phenyl ring can influence the compound's biological activity and lipophilicity, potentially enhancing its interaction with biological targets. This compound is often studied in the context of pharmaceuticals and biochemistry, particularly for its role as a building block in the synthesis of more complex molecules or as a potential therapeutic agent. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups in a given reaction environment.
Formula:C9H10FNO2
InChI:InChI=1S/C9H10FNO2/c10-7-3-1-6(2-4-7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13)
InChI key:CPGFMWPQXUXQRX-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(CC(=O)O)N)F
Synonyms:
  • 3-Amino-3-(4-Fluorophenyl)Propanoic Acid
Found 4 products.