CymitQuimica logo

CAS 32500-65-5

:

1H-Pyrazole-5-methanol,1-methyl-a-phenyl-

Description:
1H-Pyrazole-5-methanol, 1-methyl-a-phenyl- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a hydroxymethyl group (-CH2OH) at the 5-position of the pyrazole ring and a methyl group and a phenyl group at the 1-position, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxymethyl group. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with various biological targets, which can be explored for therapeutic applications. As with many organic compounds, it is important to handle it with care, following appropriate safety protocols, as it may have specific toxicity or reactivity profiles. Overall, 1H-Pyrazole-5-methanol, 1-methyl-a-phenyl- is a compound of interest in both synthetic organic chemistry and medicinal chemistry.
Formula:C11H12N2O
InChI:InChI=1S/C11H12N2O/c1-13-10(7-8-12-13)11(14)9-5-3-2-4-6-9/h2-8,11,14H,1H3
InChI key:UYVGFRVKQOCGDA-UHFFFAOYSA-N
SMILES:CN1C(=CC=N1)C(C2=CC=CC=C2)O
Synonyms:
  • (2-Methyl-2H-Pyrazol-3-Yl)-Phenyl-Methanol
Found 3 products.