CAS 32502-63-9
:1,6-Dimethyl-3-phenylpyrimido[5,4-e]-1,2,4-triazine-5,7(1H,6H)-dione
Description:
1,6-Dimethyl-3-phenylpyrimido[5,4-e]-1,2,4-triazine-5,7(1H,6H)-dione is a heterocyclic compound characterized by its complex structure, which includes a pyrimidine and triazine ring system. This compound features two methyl groups at the 1 and 6 positions, and a phenyl group at the 3 position, contributing to its unique chemical properties. The presence of the dione functional groups indicates that it has two carbonyl (C=O) functionalities, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. The compound is likely to exhibit moderate to high stability due to its aromatic and heterocyclic nature, making it potentially useful in pharmaceutical applications or as a building block in organic synthesis. Its solubility and reactivity may vary depending on the solvent and conditions used, and it may also display interesting biological activities, although specific data on its biological properties would require further investigation. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry.
Formula:C13H11N5O2
InChI:InChI=1S/C13H11N5O2/c1-17-12(19)9-11(15-13(17)20)18(2)16-10(14-9)8-6-4-3-5-7-8/h3-7H,1-2H3
InChI key:InChIKey=SFOMBJIIZPCRJH-UHFFFAOYSA-N
SMILES:O=C1C=2C(N(C)N=C(N2)C3=CC=CC=C3)=NC(=O)N1C
Synonyms:- 1,6-Dimethyl-3-phenylpyrimido[5,4-e]-1,2,4-triazine-5,7(1H,6H)-dione
- Pyrimido[5,4-e]-as-triazine-5,7(1H,6H)-dione, 1,6-dimethyl-3-phenyl-
- 3-Phenyltoxoflavine
- Pyrimido[5,4-e]-1,2,4-triazine-5,7(1H,6H)-dione, 1,6-dimethyl-3-phenyl-
- 3-Phenyltoxoflavin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyrimido[5,4-e]-1,2,4-triazine-5,7(1H,6H)-dione, 1,6-dimethyl-3-phenyl-
CAS:Formula:C13H11N5O2Purity:98%Color and Shape:SolidMolecular weight:269.25873-Phenyltoxoflavin
CAS:3-Phenyltoxoflavin (Phenyltoxoflavin) is an inhibitor of HSP90 (Kd = 585 nM) with anti-cancer activity.Formula:C13H11N5O2Purity:99.88%Color and Shape:SolidMolecular weight:269.263-Phenyl-toxoflavin
CAS:3-Phenyl-toxoflavin is a protein inhibitor that has been shown to have medicinal properties in the treatment of tumors. It induces apoptosis, or programmed cell death, in human cancer cells and has been tested on Chinese hamster ovary cells. This compound is an analog of toxoflavin, a natural product that has been found in urine samples from cancer patients. 3-Phenyl-toxoflavin inhibits kinases, which are enzymes that play a role in the growth and spread of cancer cells. As an anticancer agent, it shows promise as a potential therapeutic option for cancer patients.Formula:C13H11N5O2Purity:Min. 95%Molecular weight:269.26 g/mol




