CymitQuimica logo

CAS 32509-44-7

:

1-Decanamine, hydrobromide

Description:
1-Decanamine, hydrobromide is an organic compound that belongs to the class of primary amines. It is characterized by a long hydrophobic alkyl chain, specifically a decyl group, which contributes to its amphiphilic nature. The hydrobromide salt form indicates that it is combined with hydrobromic acid, enhancing its solubility in water and making it more stable for various applications. This compound typically appears as a white crystalline solid and is soluble in polar solvents due to the presence of the amine functional group, which can engage in hydrogen bonding. Its primary amine structure allows it to participate in various chemical reactions, including alkylation and acylation. 1-Decanamine, hydrobromide may be utilized in the synthesis of surfactants, pharmaceuticals, and other organic compounds. Safety considerations include handling it with care, as amines can be irritants, and appropriate safety measures should be taken to avoid exposure.
Formula:C10H23N・BrH
InChI:InChI=1S/C10H23N.BrH/c1-2-3-4-5-6-7-8-9-10-11;/h2-11H2,1H3;1H
InChI key:RIPUKAXZALFIMA-UHFFFAOYSA-N
SMILES:CCCCCCCCCC[NH3+].[Br-]
Found 4 products.