CAS 32510-76-2

Formula: C6H9NaO7

InChI: InChI=1S/C6H10O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h1-5,8-11H,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1

InChI key: WNFHGZLVUQBPMA-JJKGCWMISA-M

SMILES: C(=O)[C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O.[Na+]

L-Guluronic Acid Sodium Salt

CAS: 15769-56-9, 32510-76-2

Formula: C₆H₉O₇Na

Purity: 95%~99%

Molecular weight: 216.12

Ref: BP-BP4337

L-Guluronic acid sodium

CAS: 32510-76-2

L-Guluronic acid sodium is a monosaccharide that plays a crucial role in cardiac health. It is involved in the uptake and utilization of polyene carbohydrates, carotenoids, and fatty acids by human myocardial cells. L-Guluronic acid sodium has been shown to enhance the bioavailability of these essential nutrients, promoting optimal heart function. Additionally, this compound acts as a reactive analog, mimicking the effects of certain molecules involved in mammalian cell signaling pathways. This unique property makes L-Guluronic acid sodium a potential therapeutic agent for various cardiovascular conditions and may have implications in other areas such as stent technology and cancer research.

Formula: C₆H₉O₇Na

Purity: Min. 98 Area-%

Color and Shape: Powder

Molecular weight: 216.12 g/mol

Ref: 3D-MG182938