CAS 32514-66-2

Benzene, 1-[1-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-4-nonyl-

Description:

Benzene, 1-[1-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-4-nonyl- is a complex organic compound characterized by its benzene ring structure substituted with a nonyl group and multiple ethoxyethoxy groups. This compound features a hydrophobic nonyl chain, which contributes to its lipophilicity, while the ethoxyethoxy groups enhance its solubility in organic solvents. The presence of multiple ether linkages in the ethoxyethoxy substituents can influence its physical properties, such as boiling point and viscosity. Additionally, the compound may exhibit surfactant properties due to its amphiphilic nature, making it potentially useful in various applications, including as an emulsifier or dispersant in formulations. Its molecular structure suggests that it may have low volatility and moderate stability under standard conditions, although specific reactivity and stability can depend on environmental factors. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₂₃H₄₀O₄

InChI: InChI=1S/C23H40O4/c1-4-6-7-8-9-10-11-12-22-13-15-23(16-14-22)27-21(3)26-20-19-25-18-17-24-5-2/h13-16,21H,4-12,17-20H2,1-3H3

InChI key: InChIKey=GBANMXYSFHVOTH-UHFFFAOYSA-N

SMILES: O(C(OCCOCCOCC)C)C1=CC=C(CCCCCCCCC)C=C1

Synonyms:

• Benzene, 1-[1-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-4-nonyl-
• 1-[1-[2-(2-Ethoxyethoxy)ethoxy]ethoxy]-4-nonylbenzene
• NSC 195179
• Acetaldehyde, 2-(2-ethoxyethoxy)ethyl p-nonylphenyl acetal

Benzene, 1-[1-[2-(2-ethoxyethoxy)ethoxy]ethoxy]-4-nonyl-

CAS: 32514-66-2

Formula: C₂₃H₄₀O₄

Molecular weight: 380.5613

Ref: IN-DA01Q0N0