CymitQuimica logo

CAS 325141-75-1

:

2-Acetylphenylboronic acid pinacol ester

Description:
2-Acetylphenylboronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid functional group and an acetylphenyl moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as dichloromethane and ethanol, while being less soluble in water. The boronic acid functionality allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The pinacol ester formation enhances the stability of the boronic acid, facilitating its use in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is pivotal in the synthesis of complex organic molecules. Additionally, the compound may exhibit unique reactivity patterns due to the presence of both the acetyl and boronic acid groups, allowing for diverse functionalization opportunities. Safety data should be consulted for handling, as organoboron compounds can pose health risks if not managed properly.
Formula:C14H19BO3
InChI:InChI=1S/C14H19BO3/c1-10(16)11-8-6-7-9-12(11)15-17-13(2,3)14(4,5)18-15/h6-9H,1-5H3
InChI key:UTUYXAZSJTZJGG-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C(=O)C
Synonyms:
  • 2-(2-Acetylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 2-Acetylphenylboronic acid pinacol ester
  • 1-(2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL)ETHANONE
Found 5 products.