CymitQuimica logo

CAS 325142-95-8

:

2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, with CAS number 325142-95-8, is an organic compound that features a pyridine ring substituted with two methyl groups at the 2 and 6 positions and a boron-containing moiety at the 4 position. The presence of the dioxaborolane group enhances its reactivity, particularly in cross-coupling reactions, making it valuable in synthetic organic chemistry. This compound is typically characterized by its stability under ambient conditions, although it may be sensitive to moisture due to the boron atom. Its molecular structure allows for potential applications in medicinal chemistry and materials science, particularly in the development of boron-containing ligands and catalysts. The compound's solubility is influenced by the presence of the polar dioxaborolane group, which can enhance its interaction with various solvents. Overall, 2,6-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a versatile building block in organic synthesis, particularly in the context of boron chemistry.
Formula:C13H20BNO2
InChI:InChI=1S/C13H20BNO2/c1-9-7-11(8-10(2)15-9)14-16-12(3,4)13(5,6)17-14/h7-8H,1-6H3
InChI key:XYNDKPYVNTVDAH-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)C)C
Found 5 products.