CAS 325143-01-9

N,N-Diethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide

Description:

N,N-Diethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide is an organic compound characterized by its unique structure, which includes a benzamide moiety and a dioxaborolane group. The presence of the dioxaborolane ring contributes to its potential reactivity and solubility properties, making it of interest in various chemical applications, particularly in organic synthesis and medicinal chemistry. The diethyl substituents on the nitrogen atom enhance its lipophilicity, potentially influencing its biological activity and interaction with cellular targets. This compound may exhibit specific properties such as stability under certain conditions, and its reactivity can be modulated by the presence of the boron atom, which can participate in various chemical transformations. Additionally, the bulky tetramethyl groups may provide steric hindrance, affecting the compound's overall reactivity and interactions. Overall, this compound represents a versatile structure that could be explored for applications in drug development or as a reagent in synthetic chemistry.

Formula: C₁₇H₂₆BNO₃

InChI: InChI=1S/C17H26BNO3/c1-7-19(8-2)15(20)13-11-9-10-12-14(13)18-21-16(3,4)17(5,6)22-18/h9-12H,7-8H2,1-6H3

InChI key: InChIKey=YIMRYNDQFWJWIK-UHFFFAOYSA-N

SMILES: C(N(CC)CC)(=O)C1=C(C=CC=C1)B2OC(C)(C)C(C)(C)O2

Synonyms:

• Benzamide, N,N-diethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
• 2-(Diethylcarbamoyl)phenylboronic acid pinacol ester
• N,N-Diethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide

Benzamide, N,N-diethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

CAS: 325143-01-9

Formula: C₁₇H₂₆BNO₃

Molecular weight: 303.2042

Ref: IN-DA00I65P