CAS 32518-00-6
:Poly(mandelic acid)
Description:
Poly(mandelic acid) is a biodegradable polymer derived from mandelic acid, which is an aromatic alpha-hydroxy acid. This polymer exhibits several notable characteristics, including biocompatibility, making it suitable for various biomedical applications such as drug delivery systems and tissue engineering. Poly(mandelic acid) is known for its ability to degrade in physiological conditions, which is advantageous for temporary implants and controlled release formulations. The polymer typically displays good mechanical properties and thermal stability, allowing it to maintain structural integrity under various conditions. Additionally, its hydrophilic nature can facilitate interactions with biological systems, enhancing its utility in medical applications. The synthesis of poly(mandelic acid) often involves ring-opening polymerization or other polymerization techniques, resulting in a material that can be tailored for specific applications by adjusting molecular weight and copolymer composition. Overall, poly(mandelic acid) represents a versatile and environmentally friendly option in the field of polymer science and biomedical engineering.
Formula:(C8H8O3)x
InChI:InChI=1S/C8H8O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7,9H,(H,10,11)
InChI key:InChIKey=IWYDHOAUDWTVEP-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=CC=CC=C1
Synonyms:- (±)-α-Hydroxybenzeneacetic acid homopolymer
- DL-Mandelic acid homopolymer
- Amygdalic acid homopolymer
- Poly(mandelic acid)
- Benzeneacetic acid, α-hydroxy-, homopolymer
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
