CymitQuimica logo

CAS 32529-79-6

:

4-(Carbomethoxy)cyclohexane-1-carboxylic acid

Description:
4-(Carbomethoxy)cyclohexane-1-carboxylic acid, identified by its CAS number 32529-79-6, is an organic compound characterized by its cyclohexane ring structure substituted with both a carbomethoxy group and a carboxylic acid group. This compound typically exhibits properties associated with carboxylic acids, such as being a weak acid due to the presence of the carboxyl functional group, which can donate protons in solution. The carbomethoxy group contributes to the compound's reactivity and solubility in organic solvents. The presence of multiple functional groups can influence its chemical behavior, including its potential for undergoing esterification or other reactions typical of carboxylic acids and esters. Additionally, the steric and electronic effects of the cyclohexane ring and substituents can impact the compound's stability and reactivity. Overall, this compound may find applications in organic synthesis and as an intermediate in the production of more complex molecules.
Formula:C9H14O4
InChI:InChI=1S/C9H14O4/c1-13-9(12)7-4-2-6(3-5-7)8(10)11/h6-7H,2-5H2,1H3,(H,10,11)
InChI key:ZQJNPHCQABYENK-UHFFFAOYSA-N
SMILES:COC(=O)C1CCC(CC1)C(=O)O
Found 6 products.