CAS 3253-81-4

9-(6-deoxyhexofuranosyl)-9H-purin-6-amine

Description:

9-(6-deoxyhexofuranosyl)-9H-purin-6-amine, also known by its CAS number 3253-81-4, is a purine derivative characterized by the presence of a 6-deoxyhexofuranosyl group attached to the purine base. This compound features a purine ring structure, which is a bicyclic structure composed of fused imidazole and pyrimidine rings, making it a key component in various biological molecules, including nucleotides and nucleic acids. The 6-deoxyhexofuranosyl moiety indicates that it is a sugar derivative lacking a hydroxyl group at the sixth carbon, which can influence its biological activity and stability. This compound may exhibit properties relevant to nucleoside analogs, potentially impacting its role in biochemical pathways or therapeutic applications. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical entities. Overall, this substance is of interest in the fields of biochemistry and medicinal chemistry, particularly in the study of nucleosides and their analogs.

Formula: C₁₁H₁₅N₅O₄

InChI: InChI=1/C11H15N5O4/c1-4(17)8-6(18)7(19)11(20-8)16-3-15-5-9(12)13-2-14-10(5)16/h2-4,6-8,11,17-19H,1H3,(H2,12,13,14)

InChI key: DJUZHNZMVHIRPJ-RWONEVQGSA-N

SMILES: CC(C1C(C(C(n2cnc3c(N)ncnc23)O1)O)O)O

5'(R)-C-Methyladenosine

CAS: 3253-81-4

5'(R)-C-Methyladenosine is a Nucleoside Derivative - 5'-Modified nucleoside.

Formula: C₁₁H₁₅N₅O₄

Color and Shape: Solid

Molecular weight: 281.27

Ref: TM-TNU0218