CymitQuimica logo

CAS 325461-30-1

:

9,9-bis-(3,7-dimethyloctyl)-2,7-dibromofluorene

Description:
9,9-bis-(3,7-dimethyloctyl)-2,7-dibromofluorene is an organic compound characterized by its complex structure, which includes a fluorene backbone substituted with bromine and long alkyl chains. The presence of two bromine atoms at the 2 and 7 positions of the fluorene ring enhances its reactivity and potential applications in organic electronics, such as in light-emitting diodes (LEDs) and photovoltaic devices. The long alkyl chains, specifically the 3,7-dimethyloctyl groups, contribute to the compound's solubility in organic solvents and may influence its physical properties, such as melting point and boiling point. This compound is likely to exhibit interesting optical properties due to its conjugated system, making it a candidate for studies in photonics and materials science. Additionally, the presence of bromine can facilitate further chemical modifications, allowing for the synthesis of derivatives with tailored properties for specific applications. As with many organobromine compounds, safety and environmental considerations should be taken into account during handling and disposal.
Formula:C33H48Br2
InChI:InChI=1S/C33H48Br2/c1-23(2)9-7-11-25(5)17-19-33(20-18-26(6)12-8-10-24(3)4)31-21-27(34)13-15-29(31)30-16-14-28(35)22-32(30)33/h13-16,21-26H,7-12,17-20H2,1-6H3
InChI key:ZYVVOYHQVKQGEM-UHFFFAOYSA-N
SMILES:CC(C)CCCC(C)CCC1(C2=C(C=CC(=C2)Br)C3=C1C=C(C=C3)Br)CCC(C)CCCC(C)C
Synonyms:
  • 9H-Fluorene, 2,7-dibromo-9,9-bis(3,7-dimethyloctyl)-
Found 3 products.