CymitQuimica logo

CAS 325461-35-6

:

2,5-Bis(3,7-dimethyloctyloxy)terephthalaldehyde

Description:
2,5-Bis(3,7-dimethyloctyloxy)terephthalaldehyde is an organic compound characterized by its structure, which includes a terephthalaldehyde core substituted with two long-chain alkoxy groups. This compound features a central terephthalaldehyde moiety, which is a derivative of terephthalic acid, with aldehyde functional groups that enhance its reactivity and potential applications in organic synthesis. The presence of the 3,7-dimethyloctyloxy groups contributes to its hydrophobic nature, making it suitable for use in various polymeric materials and as a potential surfactant. The long alkyl chains can improve solubility in non-polar solvents and may influence the compound's thermal and mechanical properties. Additionally, the compound may exhibit interesting optical properties due to its conjugated system, making it a candidate for applications in organic electronics or as a building block in the synthesis of advanced materials. Overall, its unique structure and properties suggest potential utility in fields such as materials science and organic chemistry.
Formula:C28H46O4
InChI:InChI=1S/C28H46O4/c1-21(2)9-7-11-23(5)13-15-31-27-17-26(20-30)28(18-25(27)19-29)32-16-14-24(6)12-8-10-22(3)4/h17-24H,7-16H2,1-6H3
InChI key:JMACLBZCZVVLDQ-UHFFFAOYSA-N
SMILES:CC(C)CCCC(C)CCOC1=CC(=C(C=C1C=O)OCCC(C)CCCC(C)C)C=O
Found 3 products.