CymitQuimica logo

CAS 325491-53-0

:

pyrimidin-4-ylacetic acid

Description:
Pyrimidin-4-ylacetic acid is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features an acetic acid functional group attached to the pyrimidine ring at the 4-position, contributing to its acidic properties. Pyrimidin-4-ylacetic acid is typically a white to off-white solid, and it is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Its molecular structure allows for potential interactions with biological macromolecules, which can influence its pharmacological properties. As with many pyrimidine derivatives, it may also participate in various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C6H6N2O2
InChI:InChI=1/C6H6N2O2/c9-6(10)3-5-1-2-7-4-8-5/h1-2,4H,3H2,(H,9,10)
InChI key:INKXJLOOBMPRMB-UHFFFAOYSA-N
SMILES:c1cncnc1CC(=O)O
Synonyms:
  • 4-Pyrimidineacetic Acid
  • T6N CNJ D1VQ [WLN]2-(Pyrimidin-4-Yl)Acetic Acid
  • Pyrimidin-4-ylacetic acid
Found 5 products.