CAS 32557-37-2

Formula: C7H12O2

InChI: InChI=1S/C7H12O2/c1-5(2)6(3)4-7(8)9/h4-5H,1-3H3,(H,8,9)/b6-4+

InChI key: BLROLNSSBGCUAD-GQCTYLIASA-N

SMILES: CC(C)/C(=C/C(=O)O)/C

3,4-Dimethylpent-2-enoic acid

CAS: 32557-37-2

3,4-Dimethylpent-2-enoic acid is an organic compound that is extracted from Brucea javanica. It has been shown to have antitumor and antiviral properties as well as being a potent inhibitor of glucose residue. This pentenoic acid is also a potent antiviral agent that can be used in the treatment of brucea, which is caused by the virus known as the human T-lymphotropic virus type I (HTLV-I). 3,4-Dimethylpent-2-enoic acid inhibits viral replication by inhibiting protein synthesis at the ribosomal level, preventing RNA polymerase from binding to a specific site on the DNA strand.

Formula: C₇H₁₂O₂

Purity: Min. 95%

Molecular weight: 128.17 g/mol

Ref: 3D-HBA55737