CymitQuimica logo

CAS 3256-04-0

:

D-Glucose, O-b-D-glucopyranosyl-(1®3)-O-b-D-glucopyranosyl-(1®3)-

Description:
The chemical substance known as D-Glucose, O-b-D-glucopyranosyl-(1→3)-O-b-D-glucopyranosyl-(1→3)-, with the CAS number 3256-04-0, is a disaccharide derivative of glucose. It is characterized by its glycosidic linkages, specifically the (1→3) connections between glucose units, which influence its structural and functional properties. This compound is a type of oligosaccharide, exhibiting properties typical of carbohydrates, such as solubility in water and the ability to undergo hydrolysis. It plays a role in various biological processes, including energy metabolism and cellular signaling. The presence of multiple hydroxyl groups contributes to its reactivity and interaction with other biomolecules. Additionally, this compound may exhibit sweetness, a common characteristic of many sugars, and can be involved in various biochemical pathways. Its structural complexity and specific glycosidic bonds make it an interesting subject of study in carbohydrate chemistry and biochemistry.
Formula:C18H32O16
InChI:InChI=1S/C18H32O16/c19-1-5(23)9(25)15(6(24)2-20)33-18-14(30)16(11(27)8(4-22)32-18)34-17-13(29)12(28)10(26)7(3-21)31-17/h2,5-19,21-30H,1,3-4H2/t5-,6+,7-,8-,9-,10-,11-,12+,13-,14-,15-,16+,17+,18+/m1/s1
InChI key:UAMQRLTXHIUDST-VDSJFZOZSA-N
SMILES:C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]([C@H](O[C@H]([C@@H]2O)O[C@H]([C@H](C=O)O)[C@@H]([C@@H](CO)O)O)CO)O)O)O)O)O
Synonyms:
  • Laminaritriose(6CI,7CI,8CI)
Found 9 products.