CymitQuimica logo

CAS 325685-59-4

:

4-Chloro-6-methoxymethyl-2-phenylpyrimidine

Description:
4-Chloro-6-methoxymethyl-2-phenylpyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at position 4 and a methoxymethyl group at position 6 contributes to its reactivity and potential applications in medicinal chemistry. The phenyl group at position 2 enhances its lipophilicity, which may influence its biological activity and interaction with various targets. This compound is typically used in research and development, particularly in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests potential for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the presence of halogen and methoxy functionalities may impart unique properties, such as altered solubility and stability. As with many pyrimidine derivatives, it may exhibit biological activity, warranting further investigation into its pharmacological properties. Safety and handling precautions should be observed due to the presence of the chloro substituent.
Formula:C12H11ClN2O
InChI:InChI=1/C12H11ClN2O/c1-16-8-10-7-11(13)15-12(14-10)9-5-3-2-4-6-9/h2-7H,8H2,1H3
InChI key:GSSSCZAOXFZADM-UHFFFAOYSA-N
SMILES:COCc1cc(Cl)nc(c2ccccc2)n1
Synonyms:
  • Pyrimidine, 4-Chloro-6-(Methoxymethyl)-2-Phenyl-
  • 4-Chloro-6-(methoxymethyl)
Found 3 products.