CymitQuimica logo

CAS 3257-71-4

:

Uridine, 2',3'-O-(phenylmethylene)-

Description:
Uridine, 2',3'-O-(phenylmethylene)-, with the CAS number 3257-71-4, is a modified nucleoside derivative of uridine. This compound features a phenylmethylene group attached to the 2' and 3' hydroxyl groups of the ribose sugar moiety, which enhances its lipophilicity and may influence its biological activity. The presence of the phenylmethylene group can affect the compound's solubility, stability, and interaction with biological targets, potentially making it useful in various biochemical applications. Uridine itself is a nucleoside composed of a ribose sugar and the nitrogenous base uracil, playing a crucial role in RNA synthesis and cellular metabolism. The modification of uridine to create derivatives like 2',3'-O-(phenylmethylene)-uridine can be significant in medicinal chemistry, particularly in the development of antiviral agents or other therapeutic compounds. The compound's characteristics, including its molecular weight, melting point, and spectral properties, would typically be determined through experimental methods, providing insights into its reactivity and potential applications in research and medicine.
Formula:C16H16N2O6
InChI:InChI=1S/C16H16N2O6/c19-8-10-12-13(24-15(23-12)9-4-2-1-3-5-9)14(22-10)18-7-6-11(20)17-16(18)21/h1-7,10,12-15,19H,8H2,(H,17,20,21)/t10-,12-,13-,14-,15?/m1/s1
InChI key:NEGGNPJHTXOONQ-RKHBJWJHSA-N
SMILES:C1=CC=C(C=C1)C2O[C@@H]3[C@H](O[C@H]([C@@H]3O2)N4C=CC(=O)NC4=O)CO
Found 1 products.