CymitQuimica logo

CAS 325721-44-6

:

3-BTD

Description:
3-BTD, or 3-bromo-1,2,4-thiadiazole, is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a bromine substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. 3-BTD is often studied for its applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity and ability to act as a building block in organic synthesis. The compound may also display specific solubility characteristics, depending on the solvent used, and its stability can be influenced by environmental factors such as temperature and light. Additionally, safety considerations are essential when handling 3-BTD, as with many brominated compounds, due to potential toxicity and environmental impact. Overall, 3-BTD is a compound of interest in chemical research, particularly for its synthetic utility and potential applications in medicinal chemistry.
Formula:C16H9NO4S
InChI:InChI=1S/C16H9NO4S/c18-11-6-5-8-7-9(16(20)21-14(8)13(11)19)15-17-10-3-1-2-4-12(10)22-15/h1-7,18-19H
InChI key:LFJBGQYAGFAGNW-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)N=C(S2)C3=CC4=C(C(=C(C=C4)O)O)OC3=O
Synonyms:
  • 3-BTD
Found 4 products.