CymitQuimica logo

CAS 325770-58-9

:

Benzoyl chloride,3-(1-methylethyl)-

Description:
Benzoyl chloride, 3-(1-methylethyl)-, also known by its CAS number 325770-58-9, is an organic compound characterized by the presence of a benzoyl group attached to a branched alkyl chain. This compound typically appears as a colorless to pale yellow liquid with a pungent odor. It is known for its reactivity, particularly as an acylating agent, which allows it to participate in various chemical reactions, including the formation of esters and amides. The presence of the benzoyl group contributes to its electrophilic nature, making it useful in organic synthesis. Additionally, benzoyl chloride derivatives can exhibit varying degrees of solubility in organic solvents, while being generally insoluble in water due to their hydrophobic characteristics. Safety precautions are essential when handling this compound, as it can be corrosive and irritating to the skin, eyes, and respiratory system. Proper storage in a cool, dry place away from moisture is recommended to maintain its stability and prevent hydrolysis.
Formula:C10H11ClO
InChI:InChI=1S/C10H11ClO/c1-7(2)8-4-3-5-9(6-8)10(11)12/h3-7H,1-2H3
InChI key:IIQOURMQVWTWII-UHFFFAOYSA-N
SMILES:CC(C)C1=CC(=CC=C1)C(=O)Cl
Synonyms:
  • 3-(1-Methylethyl)benzoylchloride
  • 3-Isopropylbenzoyl chloride
Found 1 products.